Acetophenazine: Difference between revisions
m (Protected "Acetophenazine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))) |
Kiran Singh (talk | contribs) No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| IUPAC_name = 1-[10-[3-[4-(2-hydroxyethyl) piperazin-1-yl] propyl]- 10H-phenothiazin- | | verifiedrevid = 477239568 | ||
| image = Acetophenazine. | | IUPAC_name = 1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]-10H-phenothiazin-2-yl]ethanone | ||
| image =Acetophenazine.png | |||
<!--Clinical data--> | |||
| tradename = | |||
| MedlinePlus = a600010 | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 2751-68-0 | | CAS_number = 2751-68-0 | ||
| ATC_prefix = N05 | | ATC_prefix = N05 | ||
| ATC_suffix = AB07 | | ATC_suffix = AB07 | ||
| | | PubChem = 17676 | ||
| | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = | | DrugBank = DB01063 | ||
| C=23 | H=29 | N=3 | O=2 | S=1 | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = 16708 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 8620H6K4QH | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 2401 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1085 | |||
<!--Chemical data--> | |||
| C=23 | H=29 | N=3 | O=2 | S=1 | |||
| molecular_weight = 411.561 g/mol | | molecular_weight = 411.561 g/mol | ||
| | | smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(CCO)CC4)C | ||
| | | InChI = 1/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 | ||
| | | InChIKey = WNTYBHLDCKXEOT-UHFFFAOYAD | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChI = 1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 | ||
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = WNTYBHLDCKXEOT-UHFFFAOYSA-N | |||
| | |||
| | |||
}} | }} | ||
'''Acetophenazine''' is | __Notoc__ | ||
{{SI}} | |||
{{CMG}} | |||
==Overview== | |||
'''Acetophenazine''' ('''Tindal''') is a [[typical antipsychotic]] of the [[phenothiazine]] class.<ref name="urlCurrent Psychotherapeutic Drugs - Google Books">{{cite book | url = http://books.google.com/books?id=AlFxWXBz9oIC&lpg=PA138&ots=Cfh6Ovm6OH&dq=acetophenazine%20antipsychotic&pg=PA138#v=onepage&q=&f=false | title = Current Psychotherapeutic Drugs - Google Books | format = | work = | accessdate = }}</ref> | |||
== See also == | |||
* [[Typical antipsychotic]] | |||
* [[Phenothiazine]] | |||
== References == | |||
{{Reflist|2}} | |||
{{ | {{Antipsychotics}} | ||
{{Adrenergics}} | |||
{{Cholinergics}} | |||
{{Dopaminergics}} | |||
{{Histaminergics}} | |||
{{Tricyclics}} | |||
[[Category: | [[Category:Phenothiazines]] | ||
[[Category:Piperazines]] | |||
[[Category:Alcohols]] | |||
[[Category:Aromatic ketones]] | |||
[[Category:Drug]] |
Latest revision as of 12:59, 14 April 2015
Clinical data | |
---|---|
MedlinePlus | a600010 |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C23H29N3O2S |
Molar mass | 411.561 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
WikiDoc Resources for Acetophenazine |
Articles |
---|
Most recent articles on Acetophenazine Most cited articles on Acetophenazine |
Media |
Powerpoint slides on Acetophenazine |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Acetophenazine at Clinical Trials.gov Trial results on Acetophenazine Clinical Trials on Acetophenazine at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Acetophenazine NICE Guidance on Acetophenazine
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Acetophenazine Discussion groups on Acetophenazine Patient Handouts on Acetophenazine Directions to Hospitals Treating Acetophenazine Risk calculators and risk factors for Acetophenazine
|
Healthcare Provider Resources |
Causes & Risk Factors for Acetophenazine |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Acetophenazine (Tindal) is a typical antipsychotic of the phenothiazine class.[1]