Thenalidine: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
m (Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +))
No edit summary
Line 1: Line 1:
{{drugbox
{{Drugbox
| IUPAC_name       = 1-methyl-N-phenyl-''N''-(thiophen-2-ylmethyl)<br>piperidin-4-amine
| Verifiedfields = changed
| image             =
| Watchedfields = changed
| CAS_number        = 86-12-4
| verifiedrevid = 447809040
| ATC_prefix        = D04
| IUPAC_name = 1-Methyl-''N''-phenyl-''N''-(2-thienylmethyl)piperidin-4-amine
| ATC_suffix        = AA03
| image = Thenalidine.svg
| ATC_supplemental = {{ATC|R06|AX03}} {{ATC|R06|AX53}}
 
| PubChem          = 27901
<!--Clinical data-->
| DrugBank          =  
| tradename =
| C = 17 | H = 22 | N = 2 | S = 1
| pregnancy_category =   
| molecular_weight  = 286.436 g/mol
| legal_status =
| bioavailability   =  
| routes_of_administration =
| protein_bound     =  
 
| metabolism       =  
<!--Pharmacokinetic data-->
| elimination_half-life =  
| bioavailability =
| excretion         =  
| protein_bound =
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| metabolism =
| pregnancy_US      = <!-- A / B            / C / D / X -->
| elimination_half-life =
| pregnancy_category=   
| excretion =
| legal_AU          = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
 
| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
<!--Identifiers-->
| legal_UK          =  <!-- GSL        / P      / POM / CD / Class A, B, C -->
| CAS_number_Ref = {{cascite|correct|??}}
| legal_US          = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| CAS_number = 86-12-4
| legal_status      =  
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| routes_of_administration =  
| ChemSpiderID = 25957
|  smiles = s1c(ccc1)CN(c2ccccc2)C3CCN(C)CC3
|  InChI = 1/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3
| InChIKey = KLOHYVOVXOUKQI-UHFFFAOYAU
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = KLOHYVOVXOUKQI-UHFFFAOYSA-N
| ATC_prefix = D04
| ATC_suffix = AA03
| ATC_supplemental =  {{ATC|R06|AX03}} <br/>{{ATC|R06|AX53}} (combinations)
| PubChem = 27901
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04826
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6U94N2D00F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07194
 
<!--Chemical data-->
| C=17 | H=22 | N=2 | S=1
| molecular_weight = 286.436 g/mol
}}
}}


{{SI}}
'''Thenalidine''' is an [[antihistamine]] with [[anticholinergic]] properties used as an [[antipruritic]] drug.<ref>{{cite pmid|13629433}}</ref>  It was withdrawn from the US, Canadian, and UK markets in 1963 due to a risk of [[neutropenia]].<ref>{{cite web | url = http://www.drugbank.ca/drugs/DB04826 | title = Thenalidine | publisher = [[DrugBank]]}}</ref>


== References ==
{{Reflist}}


==Overview==
{{Antipruritics}}
'''Thenalidine''' is an [[antihistamine]] used as an [[antipruritic]].
{{Antihistamines}}


{{Antipruritics}}
{{Cholinergics}}
{{Histaminergics}}


[[Category:H1 receptor antagonists]]
[[Category:H1 receptor antagonists]]
[[Category:Piperidines]]
[[Category:Thiophenes]]
[[Category:Anilines]]
[[Category:Withdrawn drugs]]




 
{{respiratory-system-drug-stub}}
{{WH}}
{{dermatologic-drug-stub}}
{{WikiDoc Sources}}

Revision as of 18:55, 8 April 2015

Thenalidine
File:Thenalidine.svg
Clinical data
ATC code
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC17H22N2S
Molar mass286.436 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Thenalidine is an antihistamine with anticholinergic properties used as an antipruritic drug.[1] It was withdrawn from the US, Canadian, and UK markets in 1963 due to a risk of neutropenia.[2]

References

  1. ↑ PMID 13629433 (PMID 13629433)
    Citation will be completed automatically in a few minutes. Jump the queue or expand by hand
  2. ↑ "Thenalidine". DrugBank.

Template:Antipruritics


Template:Respiratory-system-drug-stub Template:Dermatologic-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Thenalidine&oldid=1084968"