Thenalidine: Difference between revisions
Jump to navigation
Jump to search
m (Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +)) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | Watchedfields = changed | ||
| verifiedrevid = 447809040 | |||
| | | IUPAC_name = 1-Methyl-''N''-phenyl-''N''-(2-thienylmethyl)piperidin-4-amine | ||
| | | image = Thenalidine.svg | ||
| | <!--Clinical data--> | ||
| | | tradename = | ||
| pregnancy_category = | |||
| legal_status = | |||
| bioavailability | | routes_of_administration = | ||
| protein_bound | |||
| metabolism | <!--Pharmacokinetic data--> | ||
| elimination_half-life = | | bioavailability = | ||
| excretion | | protein_bound = | ||
| metabolism = | |||
| | | elimination_half-life = | ||
| | | excretion = | ||
| | |||
<!--Identifiers--> | |||
| | | CAS_number_Ref = {{cascite|correct|??}} | ||
| | | CAS_number = 86-12-4 | ||
| | | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ||
| | | ChemSpiderID = 25957 | ||
| smiles = s1c(ccc1)CN(c2ccccc2)C3CCN(C)CC3 | |||
| InChI = 1/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3 | |||
| InChIKey = KLOHYVOVXOUKQI-UHFFFAOYAU | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3 | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = KLOHYVOVXOUKQI-UHFFFAOYSA-N | |||
| ATC_prefix = D04 | |||
| ATC_suffix = AA03 | |||
| ATC_supplemental = {{ATC|R06|AX03}} <br/>{{ATC|R06|AX53}} (combinations) | |||
| PubChem = 27901 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB04826 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 6U94N2D00F | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D07194 | |||
<!--Chemical data--> | |||
| C=17 | H=22 | N=2 | S=1 | |||
| molecular_weight = 286.436 g/mol | |||
}} | }} | ||
{{ | '''Thenalidine''' is an [[antihistamine]] with [[anticholinergic]] properties used as an [[antipruritic]] drug.<ref>{{cite pmid|13629433}}</ref> It was withdrawn from the US, Canadian, and UK markets in 1963 due to a risk of [[neutropenia]].<ref>{{cite web | url = http://www.drugbank.ca/drugs/DB04826 | title = Thenalidine | publisher = [[DrugBank]]}}</ref> | ||
== References == | |||
{{Reflist}} | |||
{{Antipruritics}} | |||
{{Antihistamines}} | |||
{{ | {{Cholinergics}} | ||
{{Histaminergics}} | |||
[[Category:H1 receptor antagonists]] | [[Category:H1 receptor antagonists]] | ||
[[Category:Piperidines]] | |||
[[Category:Thiophenes]] | |||
[[Category:Anilines]] | |||
[[Category:Withdrawn drugs]] | |||
{{respiratory-system-drug-stub}} | |||
{{ | {{dermatologic-drug-stub}} | ||
{{ |
Revision as of 18:55, 8 April 2015
File:Thenalidine.svg | |
Clinical data | |
---|---|
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C17H22N2S |
Molar mass | 286.436 g/mol |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Thenalidine is an antihistamine with anticholinergic properties used as an antipruritic drug.[1] It was withdrawn from the US, Canadian, and UK markets in 1963 due to a risk of neutropenia.[2]
References
- ↑ PMID 13629433 (PMID 13629433)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand - ↑ "Thenalidine". DrugBank.
Template:Respiratory-system-drug-stub
Template:Dermatologic-drug-stub
Categories:
- Pages with script errors
- Pages with incomplete PMID references
- Pages with broken file links
- Articles with changed ChemSpider identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Articles with changed InChI identifier
- Chemical articles with unknown parameter in Infobox drug
- Articles without EBI source
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Drugboxes which contain changes to watched fields
- H1 receptor antagonists
- Piperidines
- Thiophenes
- Anilines
- Withdrawn drugs