Bromazine: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
m (Protected "Bromazine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)))
 
No edit summary
Line 1: Line 1:
{{Drugbox
{{Drugbox
| IUPAC_name       = 2-[(4-bromophenyl)-phenylmethoxy]-''N'',''N''-dimethylethanamine
| Verifiedfields = changed
| image             = Bromazine.svg
| verifiedrevid = 459983265
| CAS_number        = 118-23-0
| IUPAC_name = 2-[(4-bromophenyl)-phenylmethoxy]-''N'',''N''-dimethylethanamine
| CAS_supplemental  = {{CAS|1808-12-4}} ([[hydrochloride]])
| image = Bromazine.svg
| ATC_prefix        = R06
 
| ATC_suffix        = AA01
<!--Clinical data-->
| PubChem          = 2444
| tradename =
| DrugBank          = APRD00710
| MedlinePlus = a682065
| C=17|H=20|Br=1|N=1|O=1
| routes_of_administration = Oral
| molecular_weight  = 334.251 g/mol
 
| bioavailability   = High
<!--Pharmacokinetic data-->
| protein_bound     = 96%
| bioavailability = High
| metabolism       = Mostly [[liver|hepatic]] ([[cytochrome P450|CYP]]-mediated), also [[kidney|renal]]
| protein_bound = 96%
| metabolism = Mostly [[liver|hepatic]] ([[cytochrome P450|CYP]]-mediated), also [[kidney|renal]]
| elimination_half-life = 1 to 4 hours
| elimination_half-life = 1 to 4 hours
| excretion        =
 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
<!--Identifiers-->
| pregnancy_US      = <!-- A / B            / C / D / X -->
| CASNo_Ref = {{cascite|correct|CAS}}
| pregnancy_category=   
| CAS_number_Ref = {{cascite|correct|??}}
| legal_AU          = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| CAS_number = 1808-12-4
| legal_CA          = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| CAS_supplemental = {{CAS|1808-12-4}}
| legal_UK          = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| ATC_prefix = R06
| legal_US          =  <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| ATC_suffix = AA01
| legal_status      =  
| PubChem = 2444
| routes_of_administration = Oral
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
  | DrugBank = DB01237
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2350
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 202J683U97
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 59177
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201245
 
<!--Chemical data-->
| C=17 | H=20 | Br=1 | N=1 | O=1
| molecular_weight = 334.251 g/mol
| smiles = Brc1ccc(cc1)C(OCCN(C)C)c2ccccc2
| InChI = 1/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3
| InChIKey = NUNIWXHYABYXKF-UHFFFAOYAG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NUNIWXHYABYXKF-UHFFFAOYSA-N
}}
}}
'''Bromazine''' ([[International Nonproprietary Name|INN]], also known as '''bromodiphenhydramine''') is an [[antihistamine]]. It is a [[bromine|brominated]] derivative of [[diphenhydramine]].


{{pharmacology-stub}}
'''Bromazine''' (trade names '''Ambrodyl''', '''Ambrodil''' and others), also known as '''bromodiphenhydramine''', is an [[antihistamine]] and [[anticholinergic]].<ref>{{cite pmid|14377226}}</ref>  It is a halogenated form of [[diphenhydramine]] and in many respects is somewhat stronger than the parent compound.  The other three halogenated diphenhydramine derivatives are used in research and [[chlorodiphenhydramine]] is also marketed with [[iododiphenhydramine]] being a much less common pharmaceutical.
 
== References ==
{{Reflist}}
 
{{Antihistamines}}
{{Antihistamines}}
{{Cholinergics}}
{{Histaminergics}}


[[Category:H1 receptor antagonists]]
[[Category:H1 receptor antagonists]]
{{WikiDoc Help Menu}}
[[Category:Organobromides]]
[[Category:Ethers]]
[[Category:Amines]]
 
 
{{respiratory-system-drug-stub}}

Revision as of 17:46, 6 April 2015

Bromazine
Clinical data
MedlinePlusa682065
Routes of
administration		Oral
ATC code
Pharmacokinetic data
BioavailabilityHigh
Protein binding96%
MetabolismMostly hepatic (CYP-mediated), also renal
Elimination half-life1 to 4 hours
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
ChEBI
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC17H20BrNO
Molar mass334.251 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Bromazine (trade names Ambrodyl, Ambrodil and others), also known as bromodiphenhydramine, is an antihistamine and anticholinergic.[1] It is a halogenated form of diphenhydramine and in many respects is somewhat stronger than the parent compound. The other three halogenated diphenhydramine derivatives are used in research and chlorodiphenhydramine is also marketed with iododiphenhydramine being a much less common pharmaceutical.

References

  1. ↑ PMID 14377226 (PMID 14377226)
    Citation will be completed automatically in a few minutes. Jump the queue or expand by hand


Template:Respiratory-system-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Bromazine&oldid=1083323"