Prednimustine
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 434002897 | IUPAC_name = (11β)-11,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoate | image = Prednimustine.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref =
| CAS_number = 29069-24-7
| ATC_prefix = L01
| ATC_suffix = AA08
| PubChem = 34457
| DrugBank_Ref =
| DrugBank =
| UNII_Ref =
| UNII = 9403SIO2S8
| KEGG_Ref =
| KEGG = C19512
| ChemSpiderID_Ref =
| ChemSpiderID = 31708
| C=35 | H=45 | Cl=2 | N=1 | O=6
| molecular_weight = 646.64 g/mol
| synonyms = [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-Dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate
| smiles = C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)COC(=O)CCCc4ccc(cc4)N(CCCl)CCCl)O)CCC5=CC(=O)C=C[C@]35C)O
| InChI = 1/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1
| InChIKey = HFVNWDWLWUCIHC-GUPDPFMOBT
| StdInChI_Ref =
| StdInChI = 1S/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = HFVNWDWLWUCIHC-GUPDPFMOSA-N
}}
|
WikiDoc Resources for Prednimustine |
|
Articles |
|---|
|
Most recent articles on Prednimustine Most cited articles on Prednimustine |
|
Media |
|
Powerpoint slides on Prednimustine |
|
Evidence Based Medicine |
|
Clinical Trials |
|
Ongoing Trials on Prednimustine at Clinical Trials.gov Trial results on Prednimustine Clinical Trials on Prednimustine at Google
|
|
Guidelines / Policies / Govt |
|
US National Guidelines Clearinghouse on Prednimustine NICE Guidance on Prednimustine
|
|
Books |
|
News |
|
Commentary |
|
Definitions |
|
Patient Resources / Community |
|
Patient resources on Prednimustine Discussion groups on Prednimustine Patient Handouts on Prednimustine Directions to Hospitals Treating Prednimustine Risk calculators and risk factors for Prednimustine
|
|
Healthcare Provider Resources |
|
Causes & Risk Factors for Prednimustine |
|
Continuing Medical Education (CME) |
|
International |
|
|
|
Business |
|
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Prednimustine is a drug used in chemotherapy. It is the ester formed from two other drugs, prednisolone and chlorambucil.
It can be associated with myoclonus.[1]
References
- ↑ Monnerat C, Gander M, Leyvraz S (January 1997). "A rare case of prednimustine-induced myoclonus". J. Natl. Cancer Inst. 89 (2): 173–4. doi:10.1093/jnci/89.2.173. PMID 8998190.