Trifluperidol
{{Drugbox | Verifiedfields = changed | verifiedrevid = 470614624 | IUPAC_name = 1-(4-fluorophenyl)- 4-{4-hydroxy- 4-[3-(trifluoromethyl)phenyl] piperidin-1-yl} butan-1-one | image = Trifluperidol.svg | width = 200
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | legal_status = | routes_of_administration = Oral
| bioavailability = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = 
| CAS_number = 749-13-3
| ATC_prefix = N05
| ATC_suffix = AD02
| ATC_supplemental =
| PubChem = 5567
| DrugBank_Ref = 
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 5366
| UNII_Ref =
| UNII = R8869Q7R8I
| ChEMBL_Ref =
| ChEMBL = 15023
| C=22 | H=23 | F=4 | N=1 | O=2
| molecular_weight = 409.417 g/mol
| smiles = FC(F)(F)c1cccc(c1)C3(O)CCN(CCCC(=O)c2ccc(F)cc2)CC3
| InChI = 1/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2
| InChIKey = GPMXUUPHFNMNDH-UHFFFAOYAW
| StdInChI_Ref =
| StdInChI = 1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2
| StdInChIKey_Ref =
| StdInChIKey = GPMXUUPHFNMNDH-UHFFFAOYSA-N
}}
Trifluperidol is a typical antipsychotic of the butyrophenone chemical class. It has general properties similar to those of haloperidol, but is considerably more potent by weight, and causes relatively more severe side effects, especially tardive dyskinesia and other extrapyramidal effects. It is used in the treatment of psychoses including mania and schizophrenia. It was discovered at Janssen Pharmaceutica in 1959.
Synthesis
References
- Gallant DM, Bishop MP, Timmons E, Steele CA, A controlled evaluation of Trifluperidol: a new potent psychopharmacologic agent, Curr Ther Res Clin Exp. 1963 Sep;27:463-71.
- Gallant DM, Bishop MP, Timmons E, Steele CA, Trifluperidol: a butyrophenone derivative, Am J Psychiatry. 1963 Nov;120:485-7.