Flufenamic acid
{{Drugbox | Watchedfields = changed | verifiedrevid = 443821617 | IUPAC_name = 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid | image = flufenamic acid.png | image2 = Flufenamic acid0.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = S4 | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral, topical
| bioavailability = | protein_bound = extensively | metabolism = Hydroxylation, glucuronidation | elimination_half-life = ~3 h | excretion = 50% urine, 36% feces
| CASNo_Ref =
| CAS_number_Ref =
| CAS_number = 530-78-9
| ATC_prefix = M01
| ATC_suffix = AG03
| PubChem = 3371
| IUPHAR_ligand = 2447
| DrugBank_Ref =
| DrugBank = DB02266
| ChemSpiderID_Ref =
| ChemSpiderID = 3254
| UNII_Ref =
| UNII = 60GCX7Y6BH
| KEGG_Ref =
| KEGG = D01581
| ChEBI_Ref =
| ChEBI = 42638
| ChEMBL_Ref =
| ChEMBL = 23588
| C=14 | H=10 | F=3 | N=1 | O=2
| molecular_weight = 281.22991 g/mol
| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)O
| InChI = 1/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| InChIKey = LPEPZBJOKDYZAD-UHFFFAOYAI
| StdInChI_Ref =
| StdInChI = 1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| StdInChIKey_Ref =
| StdInChIKey = LPEPZBJOKDYZAD-UHFFFAOYSA-N
| melting_point = 124
| melting_high = 125
| melting_notes = resolidification and remelting at 134°C to 136°C
| solubility = Practically insoluble in water; soluble in ethanol, chloroform and diethyl ether
}}
|
WikiDoc Resources for Flufenamic acid |
|
Articles |
|---|
|
Most recent articles on Flufenamic acid Most cited articles on Flufenamic acid |
|
Media |
|
Powerpoint slides on Flufenamic acid |
|
Evidence Based Medicine |
|
Clinical Trials |
|
Ongoing Trials on Flufenamic acid at Clinical Trials.gov Trial results on Flufenamic acid Clinical Trials on Flufenamic acid at Google
|
|
Guidelines / Policies / Govt |
|
US National Guidelines Clearinghouse on Flufenamic acid NICE Guidance on Flufenamic acid
|
|
Books |
|
News |
|
Commentary |
|
Definitions |
|
Patient Resources / Community |
|
Patient resources on Flufenamic acid Discussion groups on Flufenamic acid Patient Handouts on Flufenamic acid Directions to Hospitals Treating Flufenamic acid Risk calculators and risk factors for Flufenamic acid
|
|
Healthcare Provider Resources |
|
Causes & Risk Factors for Flufenamic acid |
|
Continuing Medical Education (CME) |
|
International |
|
|
|
Business |
|
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Flufenamic acid, also known as Fluffy or Fluf, is a non-steroidal anti-inflammatory drug.It is pale yellow crystalline powder. In humans, flufenamic acid acts in part by binding to and reducing the activity of prostaglandin F synthase and activating TRPC6, a property it shares with the anti-inflammatory herb St Johns Wort.
Flufenamic acid also blocks voltage-gated sodium channels responsible for the depolarising after-potential (DAP) that underlies phasic firing in the phasic firing of magnocellular neurons in the supraoptic and paraventricular nuclei.