Trifluperidol: Difference between revisions
m (Protected "Trifluperidol": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))) |
No edit summary |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
{{Drugbox| | {{Drugbox | ||
| IUPAC_name = | | Verifiedfields = changed | ||
| image = Trifluperidol. | | verifiedrevid = 470614624 | ||
| IUPAC_name = 1-(4-fluorophenyl)- 4-{4-hydroxy- 4-[3-(trifluoromethyl)phenyl] piperidin-1-yl} butan-1-one | |||
| image = Trifluperidol.png | |||
| width = 200 | | width = 200 | ||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|trifluperidol}} | |||
| pregnancy_AU = | |||
| pregnancy_US = | |||
| legal_status = | |||
| routes_of_administration = Oral | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|changed|??}} | |||
| CAS_number = 749-13-3 | | CAS_number = 749-13-3 | ||
| ATC_prefix = N05 | | ATC_prefix = N05 | ||
| ATC_suffix = AD02 | | ATC_suffix = AD02 | ||
| ATC_supplemental = | | ATC_supplemental = | ||
| PubChem = 5567 | | PubChem = 5567 | ||
| DrugBank = | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| C = 22 | H = 23 | F = 4 | N = 1 | | DrugBank = | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5366 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = R8869Q7R8I | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 15023 | |||
<!--Chemical data--> | |||
| C=22 | H=23 | F=4 | N=1 | O=2 | |||
| molecular_weight = 409.417 g/mol | | molecular_weight = 409.417 g/mol | ||
| | | smiles = FC(F)(F)c1cccc(c1)C3(O)CCN(CCCC(=O)c2ccc(F)cc2)CC3 | ||
| | | InChI = 1/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | ||
| | | InChIKey = GPMXUUPHFNMNDH-UHFFFAOYAW | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChI = 1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | ||
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChIKey = GPMXUUPHFNMNDH-UHFFFAOYSA-N | ||
| | |||
}} | }} | ||
__NOTOC__ | |||
{{SI}} | |||
{{CMG}} | |||
==Overview== | |||
==References== | '''Trifluperidol''' is a [[typical antipsychotic]] of the [[butyrophenone]] [[chemical class]]. It has general properties similar to those of [[haloperidol]], but is considerably more potent by weight, and causes relatively more severe side effects, especially [[tardive dyskinesia]] and other [[extrapyramidal symptoms|extrapyramidal]] effects. It is used in the treatment of psychoses including [[mania]] and [[schizophrenia]]. It was discovered at [[Janssen Pharmaceutica]] in 1959. | ||
==Synthesis== | |||
[[File:Trifluperidol_Synthesis.png|500px|center|thumb|Trifluperidol Synthesis: P. Janssen, J. Adriaan, {{Cite patent|GB|895309}} (1962), {{US Patent|3438991}} (1969).]] | |||
== References == | |||
{{Reflist|2}} | |||
* Gallant DM, Bishop MP, Timmons E, Steele CA, A controlled evaluation of Trifluperidol: a new potent psychopharmacologic agent, Curr Ther Res Clin Exp. 1963 Sep;27:463-71. | * Gallant DM, Bishop MP, Timmons E, Steele CA, A controlled evaluation of Trifluperidol: a new potent psychopharmacologic agent, Curr Ther Res Clin Exp. 1963 Sep;27:463-71. | ||
* Gallant DM, Bishop MP, Timmons E, Steele CA, Trifluperidol: a butyrophenone derivative, Am J Psychiatry. 1963 Nov;120:485-7. | * Gallant DM, Bishop MP, Timmons E, Steele CA, Trifluperidol: a butyrophenone derivative, Am J Psychiatry. 1963 Nov;120:485-7. | ||
{{Antipsychotics}} | |||
[[Category: | [[Category:Piperidines]] | ||
[[Category:Organofluorides]] | |||
[[Category:Drug]] | |||
[[Category:Alcohols]] |
Latest revision as of 13:10, 10 April 2015
{{Drugbox | Verifiedfields = changed | verifiedrevid = 470614624 | IUPAC_name = 1-(4-fluorophenyl)- 4-{4-hydroxy- 4-[3-(trifluoromethyl)phenyl] piperidin-1-yl} butan-1-one | image = Trifluperidol.png | width = 200
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | legal_status = | routes_of_administration = Oral
| bioavailability = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 749-13-3 | ATC_prefix = N05 | ATC_suffix = AD02 | ATC_supplemental = | PubChem = 5567 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 5366 | UNII_Ref = | UNII = R8869Q7R8I | ChEMBL_Ref = | ChEMBL = 15023
| C=22 | H=23 | F=4 | N=1 | O=2 | molecular_weight = 409.417 g/mol | smiles = FC(F)(F)c1cccc(c1)C3(O)CCN(CCCC(=O)c2ccc(F)cc2)CC3 | InChI = 1/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | InChIKey = GPMXUUPHFNMNDH-UHFFFAOYAW | StdInChI_Ref = | StdInChI = 1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | StdInChIKey_Ref = | StdInChIKey = GPMXUUPHFNMNDH-UHFFFAOYSA-N }}
WikiDoc Resources for Trifluperidol |
Articles |
---|
Most recent articles on Trifluperidol Most cited articles on Trifluperidol |
Media |
Powerpoint slides on Trifluperidol |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Trifluperidol at Clinical Trials.gov Trial results on Trifluperidol Clinical Trials on Trifluperidol at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Trifluperidol NICE Guidance on Trifluperidol
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Trifluperidol Discussion groups on Trifluperidol Patient Handouts on Trifluperidol Directions to Hospitals Treating Trifluperidol Risk calculators and risk factors for Trifluperidol
|
Healthcare Provider Resources |
Causes & Risk Factors for Trifluperidol |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Trifluperidol is a typical antipsychotic of the butyrophenone chemical class. It has general properties similar to those of haloperidol, but is considerably more potent by weight, and causes relatively more severe side effects, especially tardive dyskinesia and other extrapyramidal effects. It is used in the treatment of psychoses including mania and schizophrenia. It was discovered at Janssen Pharmaceutica in 1959.
Synthesis
References
- Gallant DM, Bishop MP, Timmons E, Steele CA, A controlled evaluation of Trifluperidol: a new potent psychopharmacologic agent, Curr Ther Res Clin Exp. 1963 Sep;27:463-71.
- Gallant DM, Bishop MP, Timmons E, Steele CA, Trifluperidol: a butyrophenone derivative, Am J Psychiatry. 1963 Nov;120:485-7.