View source for Tiazofurine


{{Drugbox
| verifiedrevid = 444227977
| IUPAC_name = (1''R'')-1-[4-(aminocarbonyl)-1,3-thiazol-2-yl]-1,4-anhydro-<small>D</small>-ribitol
| image = Tiazofurin.png

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number = 60084-10-8
| CAS_supplemental =  
| ATC_prefix = L01
| ATC_suffix = XX18
| ATC_supplemental =  
| PubChem = 457954
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 403014
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ULJ82834RE
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 108358

<!--Chemical data-->
| chemical_formula =  
| C=9 | H=12 | N=2 | O=5 | S=1 
| molecular_weight = 260.268 g/mol
| smiles = O=C(c1nc(sc1)[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO)N
| InChI = 1/C9H12N2O5S/c10-8(15)3-2-17-9(11-3)7-6(14)5(13)4(1-12)16-7/h2,4-7,12-14H,1H2,(H2,10,15)/t4-,5-,6-,7-/m1/s1
| InChIKey = FVRDYQYEVDDKCR-DBRKOABJBT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12N2O5S/c10-8(15)3-2-17-9(11-3)7-6(14)5(13)4(1-12)16-7/h2,4-7,12-14H,1H2,(H2,10,15)/t4-,5-,6-,7-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FVRDYQYEVDDKCR-DBRKOABJSA-N
| synonyms = 2-[(2''R'',3''R'',4''S'',5''R'')-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboxamide
}}
<!-- MeSHName=Tiazofurin -->__NOTOC__
{{SI}}
{{CMG}}

==Overview==
'''Tiazofurin''' is an [[enzyme inhibitor|inhibitor]] of [[IMP dehydrogenase]]. Tiazofurin and its analogues are under investigation for potential use in the treatment of cancer.<ref>{{cite journal |author=Popsavin M, Torović L, Svircev M et al. |title=Synthesis and antiproliferative activity of two new tiazofurin analogues with 2'-amido functionalities |journal=Bioorg. Med. Chem. Lett. |volume=16 |issue=10 |pages=2773–6 |year=2006 |pmid=16495053 |doi=10.1016/j.bmcl.2006.02.001}}</ref>

==References==
{{reflist|2}}



[[Category:Amides]]
[[Category:Drug]]
[[Category:Thiazoles]]