Glutamic acid (data page)

Jump to: navigation, search
The complete data for Glutamic acid
File:Hight setter 449px.gifChemical structure of Glutamic acidChemical structure of the amino acid glutamate
General information
Chemical formula: C5H9NO4 
Molar mass: 147.13 g·mol-1
Systematic name:
(2S)-2-aminopentanedioic acid
Abbreviations: E, Glu
2-amino-glutaric acid
Glutaminic acid
Database data
InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/f/h7,9H - (L)
 ATC: N/A CAS: [56-86-0] DrugBank: N/A EINECS: 200-293-7 PubChem: 23327 (D) [1], 33032 (L) [2]
Physical properties
Crystal data
Spectral data
Phase behavior
Solid properties
ρsolid: 1.538
Tm: 247-249 °C
Liquid properties
Gas properties
Hazard properties
MSDS N/AMain hazards:
- N/A
NFPA 704
NFPA 704.svg
Flash point
- N/A
R/S statement
R: N/A
S: N/A
RTECS number:
Chemical properties
XLogP: -3.386pI: 3.22pKa: 2.16, 4.15, 9.58Tautomers: 0Hydrogen bond: donor - 3;   acceptor - 5;
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)


  1. a  CID 23327 from PubChem (D-glutamic acid)
  2. a  CID 33032 from PubChem (L-glutamic acid)

v  d  e
Major families of biochemicals
Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides
Analogues of nucleic acids:The 20 Common Amino Acids ("dp" = data page)Analogues of nucleic acids:
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp)

ar:حمض الجلوتاميك (صفحة بيانات)