Glutamine (data page)

Jump to: navigation, search
The complete data for Glutamine
350px
File:Hight setter 449px.gifChemical structure of GlutamineChemical structure of the amino acid glutamine
General information
400px
Chemical formula: C5H10N2O3 
Molar mass: 146.15 g·mol-1
Systematic name:
(2S)-2-amino-4-carbamoyl-butanoic acid
Abbreviations: Q, Gln
Synonyms:
{γ/+/-/D/L}-Glutamine
2-amino-4-carbamoylbutanoic acid
{L-/D-}2-aminoglutaramic acid
AI3-32686
C00303
Cebrogen
G107
Glumin
Glutamic acid {5-/γ-} amide
{L-/D-}glutamid
Miglu-P
NSC 97925
NSC27421
Database data
SMILES: NC(=O)CCC(N)C(=O)O
InChI=1/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/f/h9H,7H2
 ATC: N/A CAS: [56-85-9] DrugBank: N/A EINECS: 200-292-1 PubChem:
738 [1], 145815 (D)[2], 5961 (L)[3]
Physical properties
Structure
Crystal data
Spectral data
UV-Vis
IR
NMR
MS
Phase behavior
Solid properties
Tm: 185 °C
Liquid properties
Gas properties
Hazard properties
MSDS N/AMain hazards:
- N/A
NFPA 704
NFPA 704.svg
Flash point
- N/A
R/S statement
R: N/A
S: N/A
RTECS number:
N/A
Chemical properties
XLogP: -4.102pI: 5.65pKa: 2.18; 9.00Tautomers: 2Hydrogen bond: donor - 3;   acceptor - 4;
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)


References

  1. a  CID 738 from PubChem (Gln)
  2. a  CID 145815 from PubChem (D)
  3. a  CID 5961 from PubChem (L)


v  d  e
Major families of biochemicals
Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides
Analogues of nucleic acids:The 20 Common Amino Acids ("dp" = data page)Analogues of nucleic acids:
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp)

ar:جلوتامين (صفحة بيانات)


Linked-in.jpg