Bacitracin (topical): Difference between revisions
Adeel Jamil (talk | contribs) (Created page with "{{DrugProjectFormSinglePage |authorTag={{AJ}} |OTC=Yes |genericName=Bacitracin |aOrAn=a |drugClass=antibiotic |indicationType=treatment |indication=deep or puncture wounds, an...") |
Gerald Chi- (talk | contribs) mNo edit summary |
||
(2 intermediate revisions by one other user not shown) | |||
Line 6: | Line 6: | ||
|drugClass=antibiotic | |drugClass=antibiotic | ||
|indicationType=treatment | |indicationType=treatment | ||
|indication=deep or puncture wounds, animal bites and serious burns | |indication=deep or puncture wounds, animal [[bites]] and serious [[burns]] | ||
|adverseReactions=[[contact dermatitis]] | |||
|blackBoxWarningTitle=<b><span style="color:#FF0000;">TITLE</span></b> | |blackBoxWarningTitle=<b><span style="color:#FF0000;">TITLE</span></b> | ||
|blackBoxWarningBody=<i><span style="color:#FF0000;">Condition Name:</span></i> (Content) | |blackBoxWarningBody=<i><span style="color:#FF0000;">Condition Name:</span></i> (Content) | ||
Line 47: | Line 48: | ||
* if swallowed, get medical help or contact a Poison Control Center right away | * if swallowed, get medical help or contact a Poison Control Center right away | ||
|clinicalTrials=* Contact dermatitis | |||
|drugBox={{Drugbox2 | |||
| Verifiedfields = changed | |||
| verifiedrevid = 457285800 | |||
| IUPAC_name = (4''R'')-4-[(2''S'')-2-({2-[(1''S'')-1-amino-2-methylbutyl]- 4,5-dihydro-1,3-thiazol-5-yl}formamido)-4-methylpentanamido]-4-{[(1''S'')- 1-{[(3''S'',6''R'',9''S'',12''R'',15''S'',18''R'',21''S'')- 18-(3-aminopropyl)-12-benzyl-15-(butan-2-yl)-3-(carbamoylmethyl)- 6-(carboxymethyl)-9-(1''H''-imidazol-5-ylmethyl)-2,5,8,11,14,17,20- heptaoxo-1,4,7,10,13,16,19-heptaazacyclopentacosan-21-yl]carbamoyl}- 2-methylbutyl]carbamoyl}butanoic acid | |||
| image = Bacitracin A.png | |||
| image2 = Bacitracin ball-and-stick.png | |||
<!--Clinical data--> | |||
| tradename = Baciim | |||
| Drugs.com = {{drugs.com|monograph|bacitracin}} | |||
| pregnancy_AU = D | |||
| pregnancy_US = C | |||
| legal_AU = S4 | |||
| legal_US = Rx-only | |||
| routes_of_administration = [[Topical]], [[Intramuscular injection|intramuscular]] | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 1405-87-4 | |||
| ATC_prefix = D06 | |||
| ATC_suffix = AX05 | |||
| ATC_supplemental = {{ATC|J01|XX10}} {{ATC|R02|AB04}} {{ATCvet|A07|AA93}} | |||
| PubChem = 439542 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB00626 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 10481985 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 58H6RWO52I | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = D00128 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 1200558 | |||
<!--Chemical data--> | |||
| C=66 | H=103 | N=17 | O=16 | S=1 | |||
| molecular_weight = 1422.69 g/mol | |||
| smiles = O=C(O)C[C@H]3NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)[C@@H](CCCN)NC(=O)[C@H](CCCCNC(=O)[C@H](CC(N)=O)NC3=O)NC(=O)[C@@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)C4N=C(SC4)\nC(N)C(C)CC)C(C)CC)C(C)CC | |||
| InChI = 1/C66H103N17O16S/c1-9-35(6)52(69)66-81-48(32-100-66)63(97)76-43(26-34(4)5)59(93)74-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)75-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-72-39)77-60(94)44(27-38-18-13-12-14-19-38)80-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)73-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,72)(H,71,89)(H,73,90)(H,74,93)(H,75,98)(H,76,97)(H,77,94)(H,78,96)(H,79,95)(H,80,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35?,36?,37?,40-,41+,42+,43-,44+,45-,46-,47+,48?,52?,53-,54-/m0/s1 | |||
| InChIKey = CLKOFPXJLQSYAH-NVOBBBONBV | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C66H103N17O16S/c1-9-35(6)52(69)66-81-48(32-100-66)63(97)76-43(26-34(4)5)59(93)74-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)75-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-72-39)77-60(94)44(27-38-18-13-12-14-19-38)80-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)73-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,72)(H,71,89)(H,73,90)(H,74,93)(H,75,98)(H,76,97)(H,77,94)(H,78,96)(H,79,95)(H,80,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35?,36?,37?,40-,41+,42+,43-,44+,45-,46-,47+,48?,52?,53-,54-/m0/s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = CLKOFPXJLQSYAH-NVOBBBONSA-N | |||
}} | |||
|storage=* Store at controlled room temperature 15°-30° C (59°-86° F) | |storage=* Store at controlled room temperature 15°-30° C (59°-86° F) | ||
|packLabel=[[File:Bacitracin topical drug label01.png|thumb|none|400px|This image is provided by the National Library of Medicine.]] | |packLabel=[[File:Bacitracin topical drug label01.png|thumb|none|400px|This image is provided by the National Library of Medicine.]] | ||
|alcohol=Alcohol-Bacitracin (topical) interaction has not been established. Talk to your doctor about the effects of taking alcohol with this medication. | |alcohol=Alcohol-Bacitracin (topical) interaction has not been established. Talk to your doctor about the effects of taking alcohol with this medication. | ||
}} | }} |
Latest revision as of 06:22, 18 May 2015
{{DrugProjectFormSinglePage |authorTag=Adeel Jamil, M.D. [1] |OTC=Yes |genericName=Bacitracin |aOrAn=a |drugClass=antibiotic |indicationType=treatment |indication=deep or puncture wounds, animal bites and serious burns |adverseReactions=contact dermatitis |blackBoxWarningTitle=TITLE |blackBoxWarningBody=Condition Name: (Content) |fdaLIADAdult=* Ask a doctor before use:
- in case of deep or puncture wounds
- animal bites
- serious burns
PURPOSE
- First aid to help prevent infection in:
- Minor cuts
- scrapes
- burns
Dosing Information
- clean the affected areas
- apply a small amount of product (an amount equal to the surface area of the tip of the finger) on the area 1 to 3 times daily
- may be covered with a sterile bandage
|offLabelAdultGuideSupport=There is limited information regarding Off-Label Guideline-Supported Use of Bacitracin (topical) in adult patients. |offLabelAdultNoGuideSupport=There is limited information regarding Off-Label Non–Guideline-Supported Use of Bacitracin (topical) in adult patients. |offLabelPedGuideSupport=There is limited information regarding Off-Label Guideline-Supported Use of Bacitracin (topical) in pediatric patients. |offLabelPedNoGuideSupport=There is limited information regarding Off-Label Non–Guideline-Supported Use of Bacitracin (topical) in pediatric patients. |warnings=* For external use only
Stop use and ask a doctor if:
- The condition persists or gets worse, or if a rash or other allergic reaction develops.
Do not use:
- If you are allergic to any of the ingredients
- in the eyes
- over large areas of the body
- longer than 1 week unless directed by a doctor
Keep out of reach of children
- if swallowed, get medical help or contact a Poison Control Center right away
|clinicalTrials=* Contact dermatitis |drugBox={{Drugbox2 | Verifiedfields = changed | verifiedrevid = 457285800 | IUPAC_name = (4R)-4-[(2S)-2-({2-[(1S)-1-amino-2-methylbutyl]- 4,5-dihydro-1,3-thiazol-5-yl}formamido)-4-methylpentanamido]-4-{[(1S)- 1-{[(3S,6R,9S,12R,15S,18R,21S)- 18-(3-aminopropyl)-12-benzyl-15-(butan-2-yl)-3-(carbamoylmethyl)- 6-(carboxymethyl)-9-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17,20- heptaoxo-1,4,7,10,13,16,19-heptaazacyclopentacosan-21-yl]carbamoyl}- 2-methylbutyl]carbamoyl}butanoic acid | image = Bacitracin A.png | image2 = Bacitracin ball-and-stick.png
| tradename = Baciim | Drugs.com = Monograph | pregnancy_AU = D | pregnancy_US = C | legal_AU = S4 | legal_US = Rx-only | routes_of_administration = Topical, intramuscular
| bioavailability = | protein_bound = | metabolism = | elimination_half-life =
| CASNo_Ref = | CAS_number_Ref = | CAS_number = 1405-87-4 | ATC_prefix = D06 | ATC_suffix = AX05 | ATC_supplemental = J01XX10 (WHO) R02AB04 (WHO) Template:ATCvet | PubChem = 439542 | DrugBank_Ref =
| DrugBank = DB00626
| ChemSpiderID_Ref = | ChemSpiderID = 10481985 | UNII_Ref = | UNII = 58H6RWO52I | KEGG_Ref = | KEGG = D00128 | ChEMBL_Ref = | ChEMBL = 1200558
| C=66 | H=103 | N=17 | O=16 | S=1 | molecular_weight = 1422.69 g/mol | smiles = O=C(O)C[C@H]3NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)[C@@H](CCCN)NC(=O)[C@H](CCCCNC(=O)[C@H](CC(N)=O)NC3=O)NC(=O)[C@@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)C4N=C(SC4)\nC(N)C(C)CC)C(C)CC)C(C)CC | InChI = 1/C66H103N17O16S/c1-9-35(6)52(69)66-81-48(32-100-66)63(97)76-43(26-34(4)5)59(93)74-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)75-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-72-39)77-60(94)44(27-38-18-13-12-14-19-38)80-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)73-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,72)(H,71,89)(H,73,90)(H,74,93)(H,75,98)(H,76,97)(H,77,94)(H,78,96)(H,79,95)(H,80,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35?,36?,37?,40-,41+,42+,43-,44+,45-,46-,47+,48?,52?,53-,54-/m0/s1 | InChIKey = CLKOFPXJLQSYAH-NVOBBBONBV | StdInChI_Ref = | StdInChI = 1S/C66H103N17O16S/c1-9-35(6)52(69)66-81-48(32-100-66)63(97)76-43(26-34(4)5)59(93)74-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)75-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-72-39)77-60(94)44(27-38-18-13-12-14-19-38)80-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)73-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,72)(H,71,89)(H,73,90)(H,74,93)(H,75,98)(H,76,97)(H,77,94)(H,78,96)(H,79,95)(H,80,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35?,36?,37?,40-,41+,42+,43-,44+,45-,46-,47+,48?,52?,53-,54-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = CLKOFPXJLQSYAH-NVOBBBONSA-N }} |storage=* Store at controlled room temperature 15°-30° C (59°-86° F)
|packLabel=
|alcohol=Alcohol-Bacitracin (topical) interaction has not been established. Talk to your doctor about the effects of taking alcohol with this medication. }}