Sulfaphenazole: Difference between revisions
Jump to navigation
Jump to search
m (Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +)) |
Rabin Bista (talk | contribs) No edit summary |
||
Line 1: | Line 1: | ||
{{Drugbox | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | Watchedfields = changed | ||
| verifiedrevid = 470473417 | |||
| IUPAC_name = 4-amino-''N''-(1-phenyl-1''H''-pyrazol-5-yl)benzenesulfonamide | |||
| | | image = sulfaphenazole.svg | ||
| | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|sulfaphenazole}} | |||
| | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| | | pregnancy_US = <!-- A / B / C / D / X --> | ||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| pregnancy_AU | | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | ||
| pregnancy_US | | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| pregnancy_category= | | legal_status = | ||
| legal_AU | | routes_of_administration = | ||
| legal_CA | |||
| legal_UK | |||
| legal_US | |||
| legal_status | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|changed|??}} | |||
| CAS_number = 526-08-9 | |||
| ATC_prefix = J01 | |||
| ATC_suffix = ED08 | |||
| ATC_supplemental = {{ATC|S01|AB05}} {{ATCvet|J01|EQ08}} | |||
| PubChem = 5335 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB06729 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5144 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 0J8L4V3F81 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01954 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1109 | |||
<!--Chemical data--> | |||
| C=15 | H=14 | N=4 | O=2 | S=1 | |||
| molecular_weight = 314.363 g/mol | |||
| smiles = O=S(=O)(c1ccc(N)cc1)Nc3ccnn3c2ccccc2 | |||
| InChI = 1/C15H14N4O2S/c16-12-6-8-14(9-7-12)22(20,21)18-15-10-11-17-19(15)13-4-2-1-3-5-13/h1-11,18H,16H2 | |||
| InChIKey = QWCJHSGMANYXCW-UHFFFAOYAJ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C15H14N4O2S/c16-12-6-8-14(9-7-12)22(20,21)18-15-10-11-17-19(15)13-4-2-1-3-5-13/h1-11,18H,16H2 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = QWCJHSGMANYXCW-UHFFFAOYSA-N | |||
}} | |||
'''Sulfaphenazole''' (or '''sulfafenazol''') is a [[sulfonamide (medicine)|sulfonamide]] [[antibacterial]].<ref>{{cite pmid|13873771}}</ref> | |||
==References== | |||
{{reflist}} | |||
{{Sulfonamides and trimethoprim}} | {{Sulfonamides and trimethoprim}} | ||
Line 38: | Line 67: | ||
{{antibiotic-stub}} | |||
{{ | |||
Revision as of 12:30, 14 April 2015
File:Sulfaphenazole.svg | |
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C15H14N4O2S |
Molar mass | 314.363 g/mol |
3D model (JSmol) | |
| |
| |
|
Sulfaphenazole (or sulfafenazol) is a sulfonamide antibacterial.[1]
References
- ↑ PMID 13873771 (PMID 13873771)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand
Categories:
- Pages with script errors
- Pages with incomplete PMID references
- Pages with broken file links
- Template:drugs.com link with non-standard subpage
- Articles with changed CASNo identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Drugboxes which contain changes to watched fields
- Sulfonamide antibiotics
- Pyrazoles