Cadralazine: Difference between revisions
m (Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)) |
Rabin Bista (talk | contribs) No edit summary |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
{{Drugbox | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | Watchedfields = changed | ||
| | | verifiedrevid = 443953677 | ||
| | | IUPAC_name = ethoxy-''N'''-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide | ||
| | | image = Cadralazine Wiki Str.png | ||
| | |||
| | | alt2 = Cadralazine molecule | ||
| | |||
| | <!--Clinical data--> | ||
| bioavailability | | tradename = | ||
| protein_bound | | Drugs.com = {{drugs.com|international|cadralazine}} | ||
| metabolism | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | | elimination_half-life = | ||
| excretion | | excretion = | ||
| | <!--Identifiers--> | ||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 64241-34-5 | |||
| | | ATC_prefix = C02 | ||
| ATC_suffix = DB04 | |||
| PubChem = 2515 | |||
| | | ChEMBL_Ref = {{ebicite|changed|EBI}} | ||
| | | ChEMBL = 2106561 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 8T96I3U713 | |||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| ChemSpiderID = 2420 | |||
| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1 | |||
| InChI = 1/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) | |||
| InChIKey = QLTVVOATEHFXLT-UHFFFAOYAD | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N | |||
<!--Chemical data--> | |||
| C=12 | H=21 | N=5 | O=3 | |||
| molecular_weight = 283.33 g/mol | |||
}} | }} | ||
__NOTOC__ | |||
{{SI}} | |||
{{CMG}} | {{CMG}} | ||
== Overview == | |||
'''Cadralazine''' is an [[antihypertensive]] of the [[hydrazinophthalazine]] [[chemical class]]. | |||
== References == | |||
{{Reflist|2}} | |||
{{Nonsympatholytic vasodilatory antihypertensives}} | |||
{{Hydrazines}} | |||
[[Category: | [[Category:drug]] | ||
[[Category:Pyridazines]] | |||
[[Category:Carbamates]] | |||
[[Category:Hydrazides]] | |||
[[Category:Alcohols]] | |||
{{ | {{antihypertensive-stub}} |
Latest revision as of 13:38, 14 April 2015
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443953677 | IUPAC_name = ethoxy-N'-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide | image = Cadralazine Wiki Str.png
| alt2 = Cadralazine molecule
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref =
| CAS_number = 64241-34-5
| ATC_prefix = C02
| ATC_suffix = DB04
| PubChem = 2515
| ChEMBL_Ref =
| ChEMBL = 2106561
| DrugBank_Ref =
| DrugBank =
| UNII_Ref =
| UNII = 8T96I3U713
| ChemSpiderID_Ref =
| ChemSpiderID = 2420
| smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1
| InChI = 1/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)
| InChIKey = QLTVVOATEHFXLT-UHFFFAOYAD
| StdInChI_Ref =
| StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19)
| StdInChIKey_Ref =
| StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N
| C=12 | H=21 | N=5 | O=3 | molecular_weight = 283.33 g/mol }}
WikiDoc Resources for Cadralazine |
Articles |
---|
Most recent articles on Cadralazine Most cited articles on Cadralazine |
Media |
Powerpoint slides on Cadralazine |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Cadralazine at Clinical Trials.gov Clinical Trials on Cadralazine at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Cadralazine
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Cadralazine Discussion groups on Cadralazine Patient Handouts on Cadralazine Directions to Hospitals Treating Cadralazine Risk calculators and risk factors for Cadralazine
|
Healthcare Provider Resources |
Causes & Risk Factors for Cadralazine |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Cadralazine is an antihypertensive of the hydrazinophthalazine chemical class.
References
Template:Nonsympatholytic vasodilatory antihypertensives
Template:Hydrazines