|
|
| Line 5: |
Line 5: |
| {{SB}} Digox, Digoxin, Lanoxin | | {{SB}} Digox, Digoxin, Lanoxin |
|
| |
|
| ==='''[[Digoxin tablet ]]'''=== | | ==='''''[[Digoxin tablet ]]'''''=== |
|
| |
|
| ==='''[[Digoxin injection]]'''=== | | ==='''''[[Digoxin injection]]'''''=== |
|
| |
|
| ==='''[[Digoxin solution]]'''=== | | ==='''''[[Digoxin solution]]'''''=== |
|
| |
|
| ==Overview== | | ==Overview== |
| Line 18: |
Line 18: |
| Cardiac glycoside | | Cardiac glycoside |
|
| |
|
| {{Distinguish|Dioxin|Digitoxin}}
| |
| {{drugbox | Watchedfields = changed
| |
| | verifiedrevid = 459476549
| |
| | IUPAC_name = <small>4-[(3''S'',5''R'',8''R'',9''S'',10''S'',12''R'',13''S'',14''S'')-3-[(2''S'',4''S'',5''R'',6''R'')-5-[(2''S'',4''S'',5''R'',6''R'')-5-[(2''S'',4''S'',5''R'',6''R'')-4,5-dihydroxy-6-methyl-oxan-2-yl]oxy-4-hydroxy-6-methyl-oxan-2-yl]oxy-4-hydroxy-6-methyl-oxan-2-yl]oxy-12,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[''a'']phenanthren-17-yl]-5''H''-furan-2-one</small>
| |
| | image = Digoxin structure 2.png
| |
| | width = 300px
| |
| | image2 = Digon ball-and-stick.png
| |
|
| |
|
| <!--Clinical data-->
| |
| | tradename = Lanoxin
| |
| | Drugs.com = {{drugs.com|monograph|digoxin}}
| |
| | MedlinePlus = a682301
| |
| | pregnancy_category = A <small>([[Australia|Au]])</small>, C <small>([[United States|U.S.]])</small>
| |
| | legal_status = S4 <small>(Au)</small>, POM <small>([[United Kingdom|UK]])</small>, ℞-only <small>(U.S.)</small>
| |
| | routes_of_administration = [[Route of administration#Enteral|Oral]], [[Intravenous therapy|Intravenous]]
| |
|
| |
| <!--Pharmacokinetic data-->
| |
| | bioavailability = 60 to 80% (Oral)
| |
| | protein_bound = 25%
| |
| | metabolism = [[Liver|Hepatic]] (16%)
| |
| | elimination_half-life = 36 to 48 [[hour]]s <br /><small>(patients with normal [[renal function]])</small><br />3.5 to 5 [[day]]s <br><small>(patients with impaired renal function)</small>
| |
| | excretion = [[Renal]]
| |
|
| |
| <!--Identifiers-->
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 20830-75-5
| |
| | ATC_prefix = C01
| |
| | ATC_suffix = AA05
| |
| | ATC_supplemental =
| |
| | StdInChI = 1S/C41H64O14/c1-19-36(47)28(42)15-34(50-19)54-38-21(3)52-35(17-30(38)44)55-37-20(2)51-33(16-29(37)43)53-24-8-10-39(4)23(13-24)6-7-26-27(39)14-31(45)40(5)25(9-11-41(26,40)48)22-12-32(46)49-18-22/h12,19-21,23-31,33-38,42-45,47-48H,6-11,13-18H2,1-5H3/t19-,20-,21-,23-,24+,25-,26-,27+,28+,29+,30+,31-,33+,34+,35+,36-,37-,38-,39+,40+,41+/m1/s1
| |
| | PubChem = 2724385
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank = DB00390
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 2006532
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = 73K4184T59
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | KEGG = D00298
| |
| | ChEBI_Ref = {{ebicite|correct|EBI}}
| |
| | ChEBI = 4551
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | ChEMBL = 1751
| |
|
| |
| <!--Chemical data-->
| |
| | C=41 | H=64 | O=14
| |
| | molecular_weight = 780.938 [[Gram|g]]/[[Mole (unit)|mol]]
| |
| | smiles = O=C\1OC/C(=C/1)[C@H]2CC[C@@]8(O)[C@]2(C)[C@H](O)C[C@H]7[C@H]8CC[C@H]6[C@]7(C)CC[C@H](O[C@@H]5O[C@H](C)[C@@H](O[C@@H]4O[C@@H]([C@@H](O[C@@H]3O[C@@H]([C@@H](O)[C@@H](O)C3)C)[C@@H](O)C4)C)[C@@H](O)C5)C6
| |
| | InChI = 1/C41H64O14/c1-19-36(47)28(42)15-34(50-19)54-38-21(3)52-35(17-30(38)44)55-37-20(2)51-33(16-29(37)43)53-24-8-10-39(4)23(13-24)6-7-26-27(39)14-31(45)40(5)25(9-11-41(26,40)48)22-12-32(46)49-18-22/h12,19-21,23-31,33-38,42-45,47-48H,6-11,13-18H2,1-5H3/t19-,20-,21-,23-,24+,25-,26-,27+,28+,29+,30+,31-,33+,34+,35+,36-,37-,38-,39+,40+,41+/m1/s1
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = LTMHDMANZUZIPE-PUGKRICDSA-N
| |
| | melting_point = 249.3
| |
| | solubility = 0.0648
| |
| }}
| |
| ==References== | | ==References== |
|
| |
|