Bithionol: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
No edit summary
mNo edit summary
Line 1: Line 1:
__NOTOC__
__NOTOC__
{{Drugbox
{{XXXXX}}
| Verifiedfields = changed
{{CMG}}
| verifiedrevid = 459980346
 
| IUPAC_name = 2,2'-sulfanediylbis(4,6-dichlorophenol)
==Overview==
| image = Bithionol.png
 
==Category==


<!--Clinical data-->
==Brand Names==
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =  


<!--Pharmacokinetic data-->
BITHIONOL<sup>®</sup> (not available in the U.S.)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =


<!--Identifiers-->
==Prescribing Information==
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 97-18-7
| ATC_prefix = D10
| ATC_suffix = AB01
| ATC_supplemental =  {{ATC|P02|BX01}} {{ATCvet|P52|AG07}}
| PubChem = 2406
| IUPHAR_ligand = 2338
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04813
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AMT77LS62O
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 290106
|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2313
|  ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3131
| SMILES = Clc2cc(Cl)cc(Sc1cc(Cl)cc(Cl)c1O)c2O
|  InChI = 1/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H
|  InChIKey = JFIOVJDNOJYLKP-UHFFFAOYAO
|  StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H
|  StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JFIOVJDNOJYLKP-UHFFFAOYSA-N


<!--Chemical data-->
'''  [[XXXXX description|Description]]'''
| C=12 | H=6 | Cl=4 | O=2 | S=1
'''| [[XXXXX clinical pharmacology|Clinical Pharmacology]]'''
| molecular_weight = 356.05 g/mol
'''| [[XXXXX microbiology|Microbiology]]'''
| synonyms = 2,4-dichloro- 6-(3,5-dichloro- 2-hydroxyphenyl)sulfanylphenol
'''| [[XXXXX indications and usage|Indications and Usage]]'''
}}
'''| [[XXXXX contraindications|Contraindications]]'''
'''| [[XXXXX warnings and precautions|Warnings and Precautions]]'''
'''| [[XXXXX adverse reactions|Adverse Reactions]]'''
'''| [[XXXXX drug interactions|Drug Interactions]]'''
'''| [[XXXXX overdosage|Overdosage]]'''
'''| [[XXXXX clinical studies|Clinical Studies]]'''
'''| [[XXXXX dosage and administration|Dosage and Administration]]'''
'''| [[XXXXX how supplied|How Supplied]]'''
'''| [[XXXXX labels and packages|Labels and Packages]]'''
 
==Mechanism of Action==
 
==References==
{{Reflist|2}}
 
[[Category:Antibiotics]]
[[Category:Wikinfect]]


{{SI}}
{{CMG}}
==Overview==
==Overview==


Revision as of 01:37, 7 January 2014


Editor-In-Chief: C. Michael Gibson, M.S., M.D. [2]

Overview

Category

Brand Names

BITHIONOL® (not available in the U.S.)

Prescribing Information

Description | Clinical Pharmacology | Microbiology | Indications and Usage | Contraindications | Warnings and Precautions | Adverse Reactions | Drug Interactions | Overdosage | Clinical Studies | Dosage and Administration | How Supplied | Labels and Packages

Mechanism of Action

References

Overview

Bithionol is an anthelmintic used to treat "Anoplocephala perfoliata" (tapeworms) in horses[1] and Fasciola hepatica (liver flukes).

References

  1. ↑ [1], Sanada Y, Senba H, Mochizuki R, et al. Evaluation of marked rise in fecal egg output after bithionol administration to horse and its application as a diagnostic marker for equine Anoplocephala perfoliata infection. J. Vet. Med. Sci. May 2009;71(5):617-620.

Template:Anthelmintics


Template:Antiinfective-drug-stub Template:Dermatologic-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Bithionol&oldid=926879"