Rhodamine B

Jump to: navigation, search
Template:Chembox E number
Rhodamine B
IUPAC name [9-(2-carboxyphenyl)-6-diethylamino-3-xanthenylidene]-diethylammonium chloride
Identifiers
3D model (JSmol)
ECHA InfoCard Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value).
Properties
C28H31ClN2O3
Molar mass 479.01034
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)

Infobox disclaimer and references

WikiDoc Resources for Rhodamine B

Articles

Most recent articles on Rhodamine B

Most cited articles on Rhodamine B

Review articles on Rhodamine B

Articles on Rhodamine B in N Eng J Med, Lancet, BMJ

Media

Powerpoint slides on Rhodamine B

Images of Rhodamine B

Photos of Rhodamine B

Podcasts & MP3s on Rhodamine B

Videos on Rhodamine B

Evidence Based Medicine

Cochrane Collaboration on Rhodamine B

Bandolier on Rhodamine B

TRIP on Rhodamine B

Clinical Trials

Ongoing Trials on Rhodamine B at Clinical Trials.gov

Trial results on Rhodamine B

Clinical Trials on Rhodamine B at Google

Guidelines / Policies / Govt

US National Guidelines Clearinghouse on Rhodamine B

NICE Guidance on Rhodamine B

NHS PRODIGY Guidance

FDA on Rhodamine B

CDC on Rhodamine B

Books

Books on Rhodamine B

News

Rhodamine B in the news

Be alerted to news on Rhodamine B

News trends on Rhodamine B

Commentary

Blogs on Rhodamine B

Definitions

Definitions of Rhodamine B

Patient Resources / Community

Patient resources on Rhodamine B

Discussion groups on Rhodamine B

Patient Handouts on Rhodamine B

Directions to Hospitals Treating Rhodamine B

Risk calculators and risk factors for Rhodamine B

Healthcare Provider Resources

Symptoms of Rhodamine B

Causes & Risk Factors for Rhodamine B

Diagnostic studies for Rhodamine B

Treatment of Rhodamine B

Continuing Medical Education (CME)

CME Programs on Rhodamine B

International

Rhodamine B en Espanol

Rhodamine B en Francais

Business

Rhodamine B in the Marketplace

Patents on Rhodamine B

Experimental / Informatics

List of terms related to Rhodamine B


Molecular Formula: C28H31N2O3Cl

Molecular Weight: 479.02 grams per mole

CAS Number: 81-88-9

SMILES structure: [Cl-].CCN(CC)c1ccc2c(OC3=CC(C=CC3=C2c4ccccc4C(O)=O)=[N+](CC)CC)c1

Rhodamine B is used in biology as a staining fluorescent dye, sometimes in combination with auramine O, as the auramine-rhodamine stain to demonstrate acid-fast organisms, notably Mycobacterium.

Rhodamine B is tunable around 610 nm when used as a laser dye.

Rhodamine B is also called Rhodamine 610, C.I. Pigment Violet 1, Basic Violet 10, or C.I. 45170.

In California, Rhodamine B is suspected to be carcinogenic and thus products containing it must contain a warning on its label.[1]

Template:Stains



Linked-in.jpg